C8H9Cl2N3O — CID 43828814
3,5-dichloro-2-(methylamino)benzohydrazide (PubChem CID 43828814) has the molecular formula C8H9Cl2N3O and a molecular weight of 234.09 g/mol. Its IUPAC name is 3,5-dichloro-2-(methylamino)benzohydrazide.
| Compound Name | 3,5-dichloro-2-(methylamino)benzohydrazide |
|---|---|
| PubChem CID | 43828814 |
| Molecular Formula | C8H9Cl2N3O |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 3,5-dichloro-2-(methylamino)benzohydrazide |
| SMILES | CNc1c(Cl)cc(Cl)cc1C(=O)NN |
| InChI | InChI=1S/C8H9Cl2N3O/c1-12-7-5(8(14)13-11)2-4(9)3-6(7)10/h2-3,12H,11H2,1H3,(H,13,14) |
| InChIKey | KBJDESFWTIXMFL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|