C19H15Cl3N4O2 — CID 66855812
N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2,6-dichlorophenyl)pyrrole-3-carboxamide (PubChem CID 66855812) has the molecular formula C19H15Cl3N4O2 and a molecular weight of 437.71 g/mol. Its IUPAC name is N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2,6-dichlorophenyl)pyrrole-3-carboxamide.
| Compound Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2,6-dichlorophenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66855812 |
| Molecular Formula | C19H15Cl3N4O2 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2,6-dichlorophenyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NN)c1NC(=O)c1ccn(-c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H15Cl3N4O2/c1-10-7-12(20)8-13(19(28)25-23)16(10)24-18(27)11-5-6-26(9-11)17-14(21)3-2-4-15(17)22/h2-9H,23H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | YELVHYPVGWZIPS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|