C19H14Cl2F3N5O2 — CID 66854239
N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 66854239) has the molecular formula C19H14Cl2F3N5O2 and a molecular weight of 472.25 g/mol. Its IUPAC name is N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66854239 |
| Molecular Formula | C19H14Cl2F3N5O2 |
| Molecular Weight | 472.25 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | N-[4-chloro-2-(hydrazinecarbonyl)-6-methylphenyl]-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NN)c1NC(=O)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C19H14Cl2F3N5O2/c1-9-6-10(20)7-11(17(30)27-25)16(9)26-18(31)14-8-15(19(22,23)24)28-29(14)13-5-3-2-4-12(13)21/h2-8H,25H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | NFWFYYYBLFCOHH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|