C17H10BrClF3N3O — CID 59240027
N-(4-bromophenyl)-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 59240027) has the molecular formula C17H10BrClF3N3O and a molecular weight of 444.64 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59240027 |
| Molecular Formula | C17H10BrClF3N3O |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | N-(4-bromophenyl)-1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C17H10BrClF3N3O/c18-10-5-7-11(8-6-10)23-16(26)14-9-15(17(20,21)22)24-25(14)13-4-2-1-3-12(13)19/h1-9H,(H,23,26) |
| InChIKey | UKSIWTSZTPCIDB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |