C18H13ClF3N3O3S — CID 57458231
1-(2-chlorophenyl)-N-(3-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 57458231) has the molecular formula C18H13ClF3N3O3S and a molecular weight of 443.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(3-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(3-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 57458231 |
| Molecular Formula | C18H13ClF3N3O3S |
| Molecular Weight | 443.83 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(3-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cc(C(F)(F)F)nn2-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H13ClF3N3O3S/c1-29(27,28)12-6-4-5-11(9-12)23-17(26)15-10-16(18(20,21)22)24-25(15)14-8-3-2-7-13(14)19/h2-10H,1H3,(H,23,26) |
| InChIKey | GHMSGUWCNLONMK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |