C23H17ClF3N3O — CID 76546077
1-(2-chlorophenyl)-N-(1-naphthalen-1-ylethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 76546077) has the molecular formula C23H17ClF3N3O and a molecular weight of 443.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(1-naphthalen-1-ylethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(1-naphthalen-1-ylethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 76546077 |
| Molecular Formula | C23H17ClF3N3O |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(1-naphthalen-1-ylethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CC(NC(=O)c1cc(C(F)(F)F)nn1-c1ccccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H17ClF3N3O/c1-14(16-10-6-8-15-7-2-3-9-17(15)16)28-22(31)20-13-21(23(25,26)27)29-30(20)19-12-5-4-11-18(19)24/h2-14H,1H3,(H,28,31) |
| InChIKey | VUXIQBZPBKIMBB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |