C18H13ClF3N3O3 — CID 71094273
1-(2-chlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 71094273) has the molecular formula C18H13ClF3N3O3 and a molecular weight of 411.77 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71094273 |
| Molecular Formula | C18H13ClF3N3O3 |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(3,4-dihydroxyphenyl)methyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(O)c(O)c1)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C18H13ClF3N3O3/c19-11-3-1-2-4-12(11)25-13(8-16(24-25)18(20,21)22)17(28)23-9-10-5-6-14(26)15(27)7-10/h1-8,26-27H,9H2,(H,23,28) |
| InChIKey | FDLYBCMXFJNJDG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|