C17H14ClF3N6O — CID 162584761
1-(2-chlorophenyl)-N-[2-(pyrimidin-2-ylamino)ethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 162584761) has the molecular formula C17H14ClF3N6O and a molecular weight of 410.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(pyrimidin-2-ylamino)ethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(pyrimidin-2-ylamino)ethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162584761 |
| Molecular Formula | C17H14ClF3N6O |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(pyrimidin-2-ylamino)ethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClF3N6O/c18-11-4-1-2-5-12(11)27-13(10-14(26-27)17(19,20)21)15(28)22-8-9-25-16-23-6-3-7-24-16/h1-7,10H,8-9H2,(H,22,28)(H,23,24,25) |
| InChIKey | RRCIZAFDVGGUJH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|