C21H17Cl2F3N4O3 — CID 90730308
1-(2-chlorophenyl)-N-[2-chloro-6-(propan-2-yloxycarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 90730308) has the molecular formula C21H17Cl2F3N4O3 and a molecular weight of 501.29 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-chloro-6-(propan-2-yloxycarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-chloro-6-(propan-2-yloxycarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90730308 |
| Molecular Formula | C21H17Cl2F3N4O3 |
| Molecular Weight | 501.29 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-chloro-6-(propan-2-yloxycarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CC(C)ONC(=O)c1cccc(Cl)c1NC(=O)c1cc(C(F)(F)F)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C21H17Cl2F3N4O3/c1-11(2)33-29-19(31)12-6-5-8-14(23)18(12)27-20(32)16-10-17(21(24,25)26)28-30(16)15-9-4-3-7-13(15)22/h3-11H,1-2H3,(H,27,32)(H,29,31) |
| InChIKey | XKVHYRTUUYDJSO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|