C25H17ClF3N3O3 — CID 68655779
methyl 3-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]benzoate (PubChem CID 68655779) has the molecular formula C25H17ClF3N3O3 and a molecular weight of 499.88 g/mol. Its IUPAC name is methyl 3-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 68655779 |
| Molecular Formula | C25H17ClF3N3O3 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | methyl 3-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(-c3cc(C(F)(F)F)nn3-c3ccccc3Cl)cc2)c1 |
| InChI | InChI=1S/C25H17ClF3N3O3/c1-35-24(34)17-5-4-6-18(13-17)30-23(33)16-11-9-15(10-12-16)21-14-22(25(27,28)29)31-32(21)20-8-3-2-7-19(20)26/h2-14H,1H3,(H,30,33) |
| InChIKey | WVHXPXKBIIEBLK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |