C24H15ClF3N3O4 — CID 59631884
5-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 59631884) has the molecular formula C24H15ClF3N3O4 and a molecular weight of 501.85 g/mol. Its IUPAC name is 5-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59631884 |
| Molecular Formula | C24H15ClF3N3O4 |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 5-[[4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(O)c(C(=O)O)c1)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H15ClF3N3O4/c25-17-3-1-2-4-18(17)31-19(12-21(30-31)24(26,27)28)13-5-7-14(8-6-13)22(33)29-15-9-10-20(32)16(11-15)23(34)35/h1-12,32H,(H,29,33)(H,34,35) |
| InChIKey | GAIPKGVBEQBMAM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|