C12H13ClN2O4 — CID 126500415
methyl 2-[4-chloro-2-methyl-6-(methylcarbamoyl)anilino]-2-oxoacetate (PubChem CID 126500415) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is methyl 2-[4-chloro-2-methyl-6-(methylcarbamoyl)anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-chloro-2-methyl-6-(methylcarbamoyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 126500415 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 2-[4-chloro-2-methyl-6-(methylcarbamoyl)anilino]-2-oxoacetate |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1NC(=O)C(=O)OC |
| InChI | InChI=1S/C12H13ClN2O4/c1-6-4-7(13)5-8(10(16)14-2)9(6)15-11(17)12(18)19-3/h4-5H,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | QPACCNLAGPUZFU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|