C11H10ClN3O6 — CID 21422144
methyl 2-[[4-chloro-6-[(2-methoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]-2-oxoacetate (PubChem CID 21422144) has the molecular formula C11H10ClN3O6 and a molecular weight of 315.67 g/mol. Its IUPAC name is methyl 2-[[4-chloro-6-[(2-methoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[4-chloro-6-[(2-methoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 21422144 |
| Molecular Formula | C11H10ClN3O6 |
| Molecular Weight | 315.67 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 2-[[4-chloro-6-[(2-methoxy-2-oxoacetyl)amino]-2-pyridinyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(Cl)cc(NC(=O)C(=O)OC)n1 |
| InChI | InChI=1S/C11H10ClN3O6/c1-20-10(18)8(16)14-6-3-5(12)4-7(13-6)15-9(17)11(19)21-2/h3-4H,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | RLAKYZMPIXTBAH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.67 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|