C9H9Cl2N3O3S — CID 141236284
ethyl N-[(4,6-dichloro-2-pyridinyl)carbamoylsulfanyl]carbamate (PubChem CID 141236284) has the molecular formula C9H9Cl2N3O3S and a molecular weight of 310.16 g/mol. Its IUPAC name is ethyl N-[(4,6-dichloro-2-pyridinyl)carbamoylsulfanyl]carbamate.
| Compound Name | ethyl N-[(4,6-dichloro-2-pyridinyl)carbamoylsulfanyl]carbamate |
|---|---|
| PubChem CID | 141236284 |
| Molecular Formula | C9H9Cl2N3O3S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | ethyl N-[(4,6-dichloro-2-pyridinyl)carbamoylsulfanyl]carbamate |
| SMILES | CCOC(=O)NSC(=O)Nc1cc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C9H9Cl2N3O3S/c1-2-17-8(15)14-18-9(16)13-7-4-5(10)3-6(11)12-7/h3-4H,2H2,1H3,(H,14,15)(H,12,13,16) |
| InChIKey | RRUZLAYCDYVSDJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|