C10H6Cl2F6N2O — CID 170315457
N-(4,6-dichloro-2-pyridinyl)-2,2,3,3,4,4-hexafluoropentanamide (PubChem CID 170315457) has the molecular formula C10H6Cl2F6N2O and a molecular weight of 355.07 g/mol. Its IUPAC name is N-(4,6-dichloro-2-pyridinyl)-2,2,3,3,4,4-hexafluoropentanamide.
| Compound Name | N-(4,6-dichloro-2-pyridinyl)-2,2,3,3,4,4-hexafluoropentanamide |
|---|---|
| PubChem CID | 170315457 |
| Molecular Formula | C10H6Cl2F6N2O |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-(4,6-dichloro-2-pyridinyl)-2,2,3,3,4,4-hexafluoropentanamide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(=O)Nc1cc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C10H6Cl2F6N2O/c1-8(13,14)10(17,18)9(15,16)7(21)20-6-3-4(11)2-5(12)19-6/h2-3H,1H3,(H,19,20,21) |
| InChIKey | GDKQCCNITGFDIY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|