C10H7F7N2O — CID 3106080
2,2,3,3,4,4,4-heptafluoro-N-(6-methyl-2-pyridinyl)butanamide (PubChem CID 3106080) has the molecular formula C10H7F7N2O and a molecular weight of 304.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(6-methyl-2-pyridinyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(6-methyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 3106080 |
| Molecular Formula | C10H7F7N2O |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(6-methyl-2-pyridinyl)butanamide |
| SMILES | Cc1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H7F7N2O/c1-5-3-2-4-6(18-5)19-7(20)8(11,12)9(13,14)10(15,16)17/h2-4H,1H3,(H,18,19,20) |
| InChIKey | LPBOTONDEPFKKE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|