C9H10F3N3O — CID 934768
1-(6-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 934768) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 1-(6-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(6-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 934768 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(6-methyl-2-pyridinyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1cccc(NC(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F3N3O/c1-6-3-2-4-7(14-6)15-8(16)13-5-9(10,11)12/h2-4H,5H2,1H3,(H2,13,14,15,16) |
| InChIKey | DZDVKXBKFDRAIM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |