C13H12F3N3O — CID 116655765
1-(2-methylquinolin-8-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 116655765) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-(2-methylquinolin-8-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-methylquinolin-8-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 116655765 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-(2-methylquinolin-8-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1ccc2cccc(NC(=O)NCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C13H12F3N3O/c1-8-5-6-9-3-2-4-10(11(9)18-8)19-12(20)17-7-13(14,15)16/h2-6H,7H2,1H3,(H2,17,19,20) |
| InChIKey | DAKPUOCLCPQPIQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |