C15H13F3N2O — CID 177451543
(E)-1,1,1-trifluoro-4-[(2-methylquinolin-8-yl)amino]pent-3-en-2-one (PubChem CID 177451543) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-[(2-methylquinolin-8-yl)amino]pent-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-[(2-methylquinolin-8-yl)amino]pent-3-en-2-one |
|---|---|
| PubChem CID | 177451543 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-[(2-methylquinolin-8-yl)amino]pent-3-en-2-one |
| SMILES | C/C(=C\C(=O)C(F)(F)F)Nc1cccc2ccc(C)nc12 |
| InChI | InChI=1S/C15H13F3N2O/c1-9-6-7-11-4-3-5-12(14(11)20-9)19-10(2)8-13(21)15(16,17)18/h3-8,19H,1-2H3/b10-8+ |
| InChIKey | SVKPDBDEHBFEMT-CSKARUKUSA-N |
| XLogP | 3.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|