C16H21N3O — CID 103929864
(2R)-2-amino-3,3-dimethyl-N-(2-methylquinolin-8-yl)butanamide (PubChem CID 103929864) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(2-methylquinolin-8-yl)butanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(2-methylquinolin-8-yl)butanamide |
|---|---|
| PubChem CID | 103929864 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(2-methylquinolin-8-yl)butanamide |
| SMILES | Cc1ccc2cccc(NC(=O)[C@H](N)C(C)(C)C)c2n1 |
| InChI | InChI=1S/C16H21N3O/c1-10-8-9-11-6-5-7-12(13(11)18-10)19-15(20)14(17)16(2,3)4/h5-9,14H,17H2,1-4H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | SVBDUUXKVZJELV-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |