C8H10ClN5O3 — CID 146387327
ethyl 2-[2-(2-amino-6-chloropyrimidin-4-yl)hydrazinyl]-2-oxoacetate (PubChem CID 146387327) has the molecular formula C8H10ClN5O3 and a molecular weight of 259.65 g/mol. Its IUPAC name is ethyl 2-[2-(2-amino-6-chloropyrimidin-4-yl)hydrazinyl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-(2-amino-6-chloropyrimidin-4-yl)hydrazinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 146387327 |
| Molecular Formula | C8H10ClN5O3 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | ethyl 2-[2-(2-amino-6-chloropyrimidin-4-yl)hydrazinyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NNc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C8H10ClN5O3/c1-2-17-7(16)6(15)14-13-5-3-4(9)11-8(10)12-5/h3H,2H2,1H3,(H,14,15)(H3,10,11,12,13) |
| InChIKey | TUWZELHHDVZKAR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|