C15H19N5O6 — CID 14097512
methyl 2-[[2-[(2-methoxy-2-oxoacetyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]amino]-2-oxoacetate (PubChem CID 14097512) has the molecular formula C15H19N5O6 and a molecular weight of 365.35 g/mol. Its IUPAC name is methyl 2-[[2-[(2-methoxy-2-oxoacetyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[2-[(2-methoxy-2-oxoacetyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 14097512 |
| Molecular Formula | C15H19N5O6 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 2-[[2-[(2-methoxy-2-oxoacetyl)amino]-6-piperidin-1-ylpyrimidin-4-yl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(N2CCCCC2)nc(NC(=O)C(=O)OC)n1 |
| InChI | InChI=1S/C15H19N5O6/c1-25-13(23)11(21)16-9-8-10(20-6-4-3-5-7-20)18-15(17-9)19-12(22)14(24)26-2/h8H,3-7H2,1-2H3,(H2,16,17,18,19,21,22) |
| InChIKey | RJXBFZRLIPHWLW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|