C13H17N5O4 — CID 12824310
methyl N-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-(methoxycarbonylamino)pyrimidin-2-yl]carbamate (PubChem CID 12824310) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl N-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-(methoxycarbonylamino)pyrimidin-2-yl]carbamate.
| Compound Name | methyl N-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-(methoxycarbonylamino)pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 12824310 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | methyl N-[4-(3,6-dihydro-2H-pyridin-1-yl)-6-(methoxycarbonylamino)pyrimidin-2-yl]carbamate |
| SMILES | COC(=O)Nc1cc(N2CC=CCC2)nc(NC(=O)OC)n1 |
| InChI | InChI=1S/C13H17N5O4/c1-21-12(19)15-9-8-10(18-6-4-3-5-7-18)16-11(14-9)17-13(20)22-2/h3-4,8H,5-7H2,1-2H3,(H2,14,15,16,17,19,20) |
| InChIKey | SIJBPIKIEWKCKQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|