C12H14N2O — CID 115969554
1-[6-(3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]ethanone (PubChem CID 115969554) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-[6-(3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 115969554 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-[6-(3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CC=CCC2)nc1 |
| InChI | InChI=1S/C12H14N2O/c1-10(15)11-5-6-12(13-9-11)14-7-3-2-4-8-14/h2-3,5-6,9H,4,7-8H2,1H3 |
| InChIKey | CCORRIXIDYPCKT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|