C8H11N3O4 — CID 102191520
methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate (PubChem CID 102191520) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate.
| Compound Name | methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 102191520 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate |
| SMILES | COC(=O)Nc1cc(OC)nc(OC)n1 |
| InChI | InChI=1S/C8H11N3O4/c1-13-6-4-5(10-8(12)15-3)9-7(11-6)14-2/h4H,1-3H3,(H,9,10,11,12) |
| InChIKey | NQKVELJQIZOORT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |