methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate

C8H11N3O4 — CID 102191520

IUPACmethyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate
SMILESCOC(=O)Nc1cc(OC)nc(OC)n1
InChIInChI=1S/C8H11N3O4/c1-13-6-4-5(10-8(12)15-3)9-7(11-6)14-2/h4H,1-3H3,(H,9,10,11,12)
InChIKeyNQKVELJQIZOORT-UHFFFAOYSA-N
MW213.19 g/mol
LogP0.67
Rot. Bonds3

About methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate

methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate (PubChem CID 102191520) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate.

Molecular Properties

Compound Namemethyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate
PubChem CID102191520
Molecular FormulaC8H11N3O4
Molecular Weight213.19 g/mol
Exact Mass213.07
IUPAC Namemethyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate
SMILESCOC(=O)Nc1cc(OC)nc(OC)n1
InChIInChI=1S/C8H11N3O4/c1-13-6-4-5(10-8(12)15-3)9-7(11-6)14-2/h4H,1-3H3,(H,9,10,11,12)
InChIKeyNQKVELJQIZOORT-UHFFFAOYSA-N
XLogP0.67
TPSA82.57 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.19
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate?
The IUPAC name of methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate (CID 102191520) is methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate.
What is the SMILES notation for methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate?
The canonical SMILES for methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate is COC(=O)Nc1cc(OC)nc(OC)n1.
What is the InChIKey of methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate?
The InChIKey is NQKVELJQIZOORT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-13-6-4-5(10-8(12)15-3)9-7(11-6)14-2/h4H,1-3H3,(H,9,10,11,12).
What are the key properties of methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate?
methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate has a molecular weight of 213.19 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,6-dimethoxypyrimidin-4-yl)carbamate is sourced from PubChem (CID 102191520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).