About N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane
N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane (PubChem CID 144808191) has the molecular formula C9H19N3O4S
and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane.
Molecular Properties
| Compound Name | N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane |
| PubChem CID | 144808191 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane |
| SMILES | CC.COc1cc(NS(C)(O)O)nc(OC)n1 |
| InChI | InChI=1S/C7H13N3O4S.C2H6/c1-13-6-4-5(10-15(3,11)12)8-7(9-6)14-2;1-2/h4,11-12H,1-3H3,(H,8,9,10);1-2H3 |
| InChIKey | JAKHUNJGCMASTH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane?
The IUPAC name of N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane (CID 144808191) is N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane.
What is the SMILES notation for N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane?
The canonical SMILES for N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane is CC.COc1cc(NS(C)(O)O)nc(OC)n1.
What is the InChIKey of N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane?
The InChIKey is JAKHUNJGCMASTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O4S.C2H6/c1-13-6-4-5(10-15(3,11)12)8-7(9-6)14-2;1-2/h4,11-12H,1-3H3,(H,8,9,10);1-2H3.
What are the key properties of N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane?
N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane has a molecular weight of 265.33 g/mol, XLogP of 2.23, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dihydroxy(methyl)-λ4-sulfanyl]-2,6-dimethoxypyrimidin-4-amine;ethane is sourced from PubChem (CID 144808191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).