C13H17N3O3 — CID 3236649
N-(2,6-dimethoxypyrimidin-4-yl)hept-5-ynamide (PubChem CID 3236649) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2,6-dimethoxypyrimidin-4-yl)hept-5-ynamide.
| Compound Name | N-(2,6-dimethoxypyrimidin-4-yl)hept-5-ynamide |
|---|---|
| PubChem CID | 3236649 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2,6-dimethoxypyrimidin-4-yl)hept-5-ynamide |
| SMILES | CC#CCCCC(=O)Nc1cc(OC)nc(OC)n1 |
| InChI | InChI=1S/C13H17N3O3/c1-4-5-6-7-8-11(17)14-10-9-12(18-2)16-13(15-10)19-3/h9H,6-8H2,1-3H3,(H,14,15,16,17) |
| InChIKey | CXPFAJAHRRKOTD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|