C13H18N4O3 — CID 172888762
N-[3-[(2,6-dimethoxypyrimidin-4-yl)amino]cyclobutyl]prop-2-enamide (PubChem CID 172888762) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[3-[(2,6-dimethoxypyrimidin-4-yl)amino]cyclobutyl]prop-2-enamide.
| Compound Name | N-[3-[(2,6-dimethoxypyrimidin-4-yl)amino]cyclobutyl]prop-2-enamide |
|---|---|
| PubChem CID | 172888762 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[3-[(2,6-dimethoxypyrimidin-4-yl)amino]cyclobutyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(Nc2cc(OC)nc(OC)n2)C1 |
| InChI | InChI=1S/C13H18N4O3/c1-4-11(18)15-9-5-8(6-9)14-10-7-12(19-2)17-13(16-10)20-3/h4,7-9H,1,5-6H2,2-3H3,(H,15,18)(H,14,16,17) |
| InChIKey | FQJKODWPIKBDIB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|