C10H15N5O2 — CID 39830961
(3S)-3-[(2-amino-6-methoxypyrimidin-4-yl)amino]-1-methylpyrrolidin-2-one (PubChem CID 39830961) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (3S)-3-[(2-amino-6-methoxypyrimidin-4-yl)amino]-1-methylpyrrolidin-2-one.
| Compound Name | (3S)-3-[(2-amino-6-methoxypyrimidin-4-yl)amino]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 39830961 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3S)-3-[(2-amino-6-methoxypyrimidin-4-yl)amino]-1-methylpyrrolidin-2-one |
| SMILES | COc1cc(N[C@H]2CCN(C)C2=O)nc(N)n1 |
| InChI | InChI=1S/C10H15N5O2/c1-15-4-3-6(9(15)16)12-7-5-8(17-2)14-10(11)13-7/h5-6H,3-4H2,1-2H3,(H3,11,12,13,14)/t6-/m0/s1 |
| InChIKey | XJAZQPVLEYSMBR-LURJTMIESA-N |
| XLogP | -0.29 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |