C16H25N5O2 — CID 56821485
2-[4-[(4-methoxypyrimidin-2-yl)amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 56821485) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[4-[(4-methoxypyrimidin-2-yl)amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[(4-methoxypyrimidin-2-yl)amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 56821485 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[4-[(4-methoxypyrimidin-2-yl)amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccnc(NC2CCN(CC(=O)N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C16H25N5O2/c1-23-14-4-7-17-16(19-14)18-13-5-10-20(11-6-13)12-15(22)21-8-2-3-9-21/h4,7,13H,2-3,5-6,8-12H2,1H3,(H,17,18,19) |
| InChIKey | PXSMDLGKBCOSKY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |