C13H13N3O3 — CID 3867896
N-(2,6-dimethoxypyrimidin-4-yl)benzamide (PubChem CID 3867896) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-(2,6-dimethoxypyrimidin-4-yl)benzamide.
| Compound Name | N-(2,6-dimethoxypyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 3867896 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(2,6-dimethoxypyrimidin-4-yl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)nc(OC)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-18-11-8-10(15-13(16-11)19-2)14-12(17)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,14,15,16,17) |
| InChIKey | KHTWANKRBONEDH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |