C20H21N5O3 — CID 22478791
N-(2-aminophenyl)-4-[[(2,6-dimethoxypyrimidin-4-yl)amino]methyl]benzamide (PubChem CID 22478791) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(2,6-dimethoxypyrimidin-4-yl)amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[(2,6-dimethoxypyrimidin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 22478791 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(2,6-dimethoxypyrimidin-4-yl)amino]methyl]benzamide |
| SMILES | COc1cc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)nc(OC)n1 |
| InChI | InChI=1S/C20H21N5O3/c1-27-18-11-17(24-20(25-18)28-2)22-12-13-7-9-14(10-8-13)19(26)23-16-6-4-3-5-15(16)21/h3-11H,12,21H2,1-2H3,(H,23,26)(H,22,24,25) |
| InChIKey | XMAUBKDJVYKLGX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|