C24H22ClN7O — CID 20786083
N-(2-aminophenyl)-4-[[[4-chloro-6-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]methyl]benzamide (PubChem CID 20786083) has the molecular formula C24H22ClN7O and a molecular weight of 459.94 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-chloro-6-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-chloro-6-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 20786083 |
| Molecular Formula | C24H22ClN7O |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-chloro-6-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2nc(Cl)cc(NCc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C24H22ClN7O/c25-21-12-22(28-15-17-4-3-11-27-13-17)32-24(31-21)29-14-16-7-9-18(10-8-16)23(33)30-20-6-2-1-5-19(20)26/h1-13H,14-15,26H2,(H,30,33)(H2,28,29,31,32) |
| InChIKey | SHOFNVAKFGSHCF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|