C21H19N4O3- — CID 57350010
N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(pyridin-3-ylmethyl)carbamate (PubChem CID 57350010) has the molecular formula C21H19N4O3- and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 57350010 |
| Molecular Formula | C21H19N4O3- |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N-(pyridin-3-ylmethyl)carbamate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN(Cc2cccnc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)24-20(26)17-9-7-15(8-10-17)13-25(21(27)28)14-16-4-3-11-23-12-16/h1-12H,13-14,22H2,(H,24,26)(H,27,28)/p-1 |
| InChIKey | QRWITSVWAZUPRQ-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|