C12H16N2O4 — CID 18506791
tert-butyl N-(4-formyl-6-methoxy-2-pyridinyl)carbamate (PubChem CID 18506791) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is tert-butyl N-(4-formyl-6-methoxy-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(4-formyl-6-methoxy-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 18506791 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | tert-butyl N-(4-formyl-6-methoxy-2-pyridinyl)carbamate |
| SMILES | COc1cc(C=O)cc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H16N2O4/c1-12(2,3)18-11(16)14-9-5-8(7-15)6-10(13-9)17-4/h5-7H,1-4H3,(H,13,14,16) |
| InChIKey | OYNUROZVSWFMDK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|