C12H15ClN2O4 — CID 146241727
methyl 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate (PubChem CID 146241727) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is methyl 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate.
| Compound Name | methyl 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 146241727 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | methyl 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C12H15ClN2O4/c1-12(2,3)19-11(17)15-9-6-7(10(16)18-4)5-8(13)14-9/h5-6H,1-4H3,(H,14,15,17) |
| InChIKey | RQJHQDWNHKTXLA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|