C9H12ClN3O2 — CID 57415766
tert-butyl N-(6-chloropyridazin-3-yl)carbamate (PubChem CID 57415766) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is tert-butyl N-(6-chloropyridazin-3-yl)carbamate.
| Compound Name | tert-butyl N-(6-chloropyridazin-3-yl)carbamate |
|---|---|
| PubChem CID | 57415766 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | tert-butyl N-(6-chloropyridazin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C9H12ClN3O2/c1-9(2,3)15-8(14)11-7-5-4-6(10)12-13-7/h4-5H,1-3H3,(H,11,13,14) |
| InChIKey | FTDBVEUCBIBDHS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |