C19H25N5O2 — CID 113043128
tert-butyl N-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]carbamate (PubChem CID 113043128) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl N-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113043128 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | tert-butyl N-[6-(4-phenylpiperazin-1-yl)pyridazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N2CCN(c3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C19H25N5O2/c1-19(2,3)26-18(25)20-16-9-10-17(22-21-16)24-13-11-23(12-14-24)15-7-5-4-6-8-15/h4-10H,11-14H2,1-3H3,(H,20,21,25) |
| InChIKey | ORZYECWNBOYCBP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |