C18H23N5O — CID 113043638
N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]propanamide (PubChem CID 113043638) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]propanamide.
| Compound Name | N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]propanamide |
|---|---|
| PubChem CID | 113043638 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2CCN(c3cccc(C)c3)CC2)nn1 |
| InChI | InChI=1S/C18H23N5O/c1-3-18(24)19-16-7-8-17(21-20-16)23-11-9-22(10-12-23)15-6-4-5-14(2)13-15/h4-8,13H,3,9-12H2,1-2H3,(H,19,20,24) |
| InChIKey | IPWDUXIQUXZXFY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |