C18H23N5O — CID 39181745
2-amino-N-[6-[4-(3-methylphenyl)piperazin-1-yl]-3-pyridinyl]acetamide (PubChem CID 39181745) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-amino-N-[6-[4-(3-methylphenyl)piperazin-1-yl]-3-pyridinyl]acetamide.
| Compound Name | 2-amino-N-[6-[4-(3-methylphenyl)piperazin-1-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 39181745 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-amino-N-[6-[4-(3-methylphenyl)piperazin-1-yl]-3-pyridinyl]acetamide |
| SMILES | Cc1cccc(N2CCN(c3ccc(NC(=O)CN)cn3)CC2)c1 |
| InChI | InChI=1S/C18H23N5O/c1-14-3-2-4-16(11-14)22-7-9-23(10-8-22)17-6-5-15(13-20-17)21-18(24)12-19/h2-6,11,13H,7-10,12,19H2,1H3,(H,21,24) |
| InChIKey | FGQSJFQUFVZYOI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |