C22H29N5O — CID 113043644
N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]cyclohexanecarboxamide (PubChem CID 113043644) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 113043644 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-[6-[4-(3-methylphenyl)piperazin-1-yl]pyridazin-3-yl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(N2CCN(c3ccc(NC(=O)C4CCCCC4)nn3)CC2)c1 |
| InChI | InChI=1S/C22H29N5O/c1-17-6-5-9-19(16-17)26-12-14-27(15-13-26)21-11-10-20(24-25-21)23-22(28)18-7-3-2-4-8-18/h5-6,9-11,16,18H,2-4,7-8,12-15H2,1H3,(H,23,24,28) |
| InChIKey | SFBHADYMANYQBW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |