C19H22N4O3 — CID 122660230
1-[6-[[2-(3-methylphenyl)acetyl]amino]pyridazin-3-yl]piperidine-3-carboxylic acid (PubChem CID 122660230) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[6-[[2-(3-methylphenyl)acetyl]amino]pyridazin-3-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[6-[[2-(3-methylphenyl)acetyl]amino]pyridazin-3-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122660230 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[6-[[2-(3-methylphenyl)acetyl]amino]pyridazin-3-yl]piperidine-3-carboxylic acid |
| SMILES | Cc1cccc(CC(=O)Nc2ccc(N3CCCC(C(=O)O)C3)nn2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-13-4-2-5-14(10-13)11-18(24)20-16-7-8-17(22-21-16)23-9-3-6-15(12-23)19(25)26/h2,4-5,7-8,10,15H,3,6,9,11-12H2,1H3,(H,25,26)(H,20,21,24) |
| InChIKey | RIGHRYXQFICJBT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |