C20H25N5O — CID 113043076
N-[6-(4-benzylpiperazin-1-yl)pyridazin-3-yl]cyclobutanecarboxamide (PubChem CID 113043076) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[6-(4-benzylpiperazin-1-yl)pyridazin-3-yl]cyclobutanecarboxamide.
| Compound Name | N-[6-(4-benzylpiperazin-1-yl)pyridazin-3-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113043076 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[6-(4-benzylpiperazin-1-yl)pyridazin-3-yl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)nn1)C1CCC1 |
| InChI | InChI=1S/C20H25N5O/c26-20(17-7-4-8-17)21-18-9-10-19(23-22-18)25-13-11-24(12-14-25)15-16-5-2-1-3-6-16/h1-3,5-6,9-10,17H,4,7-8,11-15H2,(H,21,22,26) |
| InChIKey | MOVPFKBCNWWEFU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |