C22H28ClN5O — CID 96558501
(3S)-N-(1-benzylpiperidin-4-yl)-1-(6-chloropyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 96558501) has the molecular formula C22H28ClN5O and a molecular weight of 413.95 g/mol. Its IUPAC name is (3S)-N-(1-benzylpiperidin-4-yl)-1-(6-chloropyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(1-benzylpiperidin-4-yl)-1-(6-chloropyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 96558501 |
| Molecular Formula | C22H28ClN5O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (3S)-N-(1-benzylpiperidin-4-yl)-1-(6-chloropyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)[C@H]1CCCN(c2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C22H28ClN5O/c23-20-8-9-21(26-25-20)28-12-4-7-18(16-28)22(29)24-19-10-13-27(14-11-19)15-17-5-2-1-3-6-17/h1-3,5-6,8-9,18-19H,4,7,10-16H2,(H,24,29)/t18-/m0/s1 |
| InChIKey | RURJAEFHQNPQHP-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |