C22H29N5O2 — CID 95115278
(3R)-N-(1-benzylpiperidin-4-yl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide (PubChem CID 95115278) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (3R)-N-(1-benzylpiperidin-4-yl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1-benzylpiperidin-4-yl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115278 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3R)-N-(1-benzylpiperidin-4-yl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)[C@@H]1CCCN(c2cn[nH]c(=O)c2)C1 |
| InChI | InChI=1S/C22H29N5O2/c28-21-13-20(14-23-25-21)27-10-4-7-18(16-27)22(29)24-19-8-11-26(12-9-19)15-17-5-2-1-3-6-17/h1-3,5-6,13-14,18-19H,4,7-12,15-16H2,(H,24,29)(H,25,28)/t18-/m1/s1 |
| InChIKey | PZVCZMRHZYTKBX-GOSISDBHSA-N |
| XLogP | 1.77 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |