C17H19ClN4O2 — CID 95115412
(3R)-N-[(2-chlorophenyl)methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide (PubChem CID 95115412) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is (3R)-N-[(2-chlorophenyl)methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(2-chlorophenyl)methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115412 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3R)-N-[(2-chlorophenyl)methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)[C@@H]1CCCN(c2cn[nH]c(=O)c2)C1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-15-6-2-1-4-12(15)9-19-17(24)13-5-3-7-22(11-13)14-8-16(23)21-20-10-14/h1-2,4,6,8,10,13H,3,5,7,9,11H2,(H,19,24)(H,21,23)/t13-/m1/s1 |
| InChIKey | YUEDNMZPKQBBLS-CYBMUJFWSA-N |
| XLogP | 1.96 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |