C21H29N5O2 — CID 95115454
(3R)-N-[[4-(diethylamino)phenyl]methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide (PubChem CID 95115454) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (3R)-N-[[4-(diethylamino)phenyl]methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[[4-(diethylamino)phenyl]methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115454 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (3R)-N-[[4-(diethylamino)phenyl]methyl]-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H]2CCCN(c3cn[nH]c(=O)c3)C2)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-3-25(4-2)18-9-7-16(8-10-18)13-22-21(28)17-6-5-11-26(15-17)19-12-20(27)24-23-14-19/h7-10,12,14,17H,3-6,11,13,15H2,1-2H3,(H,22,28)(H,24,27)/t17-/m1/s1 |
| InChIKey | DFXKLILDVNYSNT-QGZVFWFLSA-N |
| XLogP | 2.15 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|