C18H21ClN4O2 — CID 91906995
N-[(4-chlorophenyl)methyl]-2-[1-(6-oxo-1H-pyridazin-4-yl)piperidin-3-yl]acetamide (PubChem CID 91906995) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[1-(6-oxo-1H-pyridazin-4-yl)piperidin-3-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[1-(6-oxo-1H-pyridazin-4-yl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 91906995 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[1-(6-oxo-1H-pyridazin-4-yl)piperidin-3-yl]acetamide |
| SMILES | O=C(CC1CCCN(c2cn[nH]c(=O)c2)C1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN4O2/c19-15-5-3-13(4-6-15)10-20-17(24)8-14-2-1-7-23(12-14)16-9-18(25)22-21-11-16/h3-6,9,11,14H,1-2,7-8,10,12H2,(H,20,24)(H,22,25) |
| InChIKey | TUVUQSRTPBIMFJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |