C22H29N5O2 — CID 95115690
(3S)-1-(1-methyl-6-oxopyridazin-4-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 95115690) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (3S)-1-(1-methyl-6-oxopyridazin-4-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(1-methyl-6-oxopyridazin-4-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115690 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3S)-1-(1-methyl-6-oxopyridazin-4-yl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cn1ncc(N2CCC[C@H](C(=O)NCc3ccc(N4CCCC4)cc3)C2)cc1=O |
| InChI | InChI=1S/C22H29N5O2/c1-25-21(28)13-20(15-24-25)27-12-4-5-18(16-27)22(29)23-14-17-6-8-19(9-7-17)26-10-2-3-11-26/h6-9,13,15,18H,2-5,10-12,14,16H2,1H3,(H,23,29)/t18-/m0/s1 |
| InChIKey | PCOKTGPYGYJONF-SFHVURJKSA-N |
| XLogP | 1.91 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|