C29H35N5O2 — CID 53204140
1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(4-piperidin-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 53204140) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(4-piperidin-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(4-piperidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53204140 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 1-(1-benzyl-6-oxopyridazin-4-yl)-N-[(4-piperidin-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCCC2)cc1)C1CCCN(c2cnn(Cc3ccccc3)c(=O)c2)C1 |
| InChI | InChI=1S/C29H35N5O2/c35-28-18-27(20-31-34(28)21-24-8-3-1-4-9-24)33-17-7-10-25(22-33)29(36)30-19-23-11-13-26(14-12-23)32-15-5-2-6-16-32/h1,3-4,8-9,11-14,18,20,25H,2,5-7,10,15-17,19,21-22H2,(H,30,36) |
| InChIKey | OWNPXWOVPHSXRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|